Introduction:Basic information about CAS 15912-68-2|6-fluoro-2-methylquinolin-4-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-fluoro-2-methylquinolin-4-ol |
|---|
| CAS Number | 15912-68-2 | Molecular Weight | 177.175 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 275.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H8FNO | Melting Point | 273-277 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 120.5±27.3 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 6-fluoro-4-hydroxy-2-methylquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 275.7±40.0 °C at 760 mmHg |
|---|
| Melting Point | 273-277 °C(lit.) |
|---|
| Molecular Formula | C10H8FNO |
|---|
| Molecular Weight | 177.175 |
|---|
| Flash Point | 120.5±27.3 °C |
|---|
| Exact Mass | 177.058990 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 3.54 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | BKXCHVFCJZJATJ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c2cc(F)ccc2[nH]1 |
|---|
| Storage condition | Room temperature. |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-FLUORO-2-METHYL-4-QUINOLINOL |
| 4-Hydroxy-6-fluor-2-methyl-chinolin |
| MFCD00041442 |
| 6-fluoro-2-methyl-1H-quinolin-4-one |
| EINECS 240-054-4 |
| 4-quinolinol, 6-fluoro-2-methyl- |
| 6-FLUORO-4-HYDROXYQUINALDINE |
| 6-Fluoro-4-hydroxy-2-methylquinoline,tech |
| 6-Fluoro-2-methyl-4(1H)-quinolinone |
| 6-Fluoro-4-hydroxy-2-methylquinoline |
| 6-fluoro-2-methyl-4-quinolone |
| 6-fluoro-2-methylquinolin-4-ol |
| 4(1H)-Quinolinone, 6-fluoro-2-methyl- |