Introduction：Basic information about CAS 1204-14-4|2-Methyl-4,6,8-trichloroquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-4,6,8-trichloroquinoline |
|---|
| CAS Number | 1204-14-4 | Molecular Weight | 246.520 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 324.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6Cl3N | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | 179.7±12.1 °C |
|---|
| Symbol |
GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 4,6,8-trichloro-2-methylquinoline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 324.2±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H6Cl3N |
|---|
| Molecular Weight | 246.520 |
|---|
| Flash Point | 179.7±12.1 °C |
|---|
| Exact Mass | 244.956589 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.21 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.651 |
|---|
| InChIKey | MLCCGRNOVHTMML-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(Cl)c2cc(Cl)cc(Cl)c2n1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H318-H413 |
|---|
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
|---|
| RIDADR | UN 2811 6.1 / PGIII |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4,6,8-Trichlor-chinaldin |
| 2-Methyl-4,6,8-trichloroquinoline |
| 4,6,8-trichloro-2-methyl-quinoline |
| QU136 |
| 4,6,8-TRICHLOROQUINALDINE |
| 4,6,8-Trichloro-2-methylquinoline |
| 2-methyl-4,6,8-trichloro-quinoline |
| Quinoline, 4,6,8-trichloro-2-methyl- |
