Introduction:Basic information about CAS 21629-48-1|7-chloro-2,8-dimethylquinolin-4-ol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-chloro-2,8-dimethylquinolin-4-ol |
|---|
| CAS Number | 21629-48-1 | Molecular Weight | 207.656 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 329.5±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10ClNO | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 153.1±27.9 °C |
|---|
| Symbol | GHS05, GHS06 | Signal Word | Danger |
|---|
Names
| Name | 7-chloro-2,8-dimethyl-1H-quinolin-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 329.5±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10ClNO |
|---|
| Molecular Weight | 207.656 |
|---|
| Flash Point | 153.1±27.9 °C |
|---|
| Exact Mass | 207.045090 |
|---|
| PSA | 33.12000 |
|---|
| LogP | 4.58 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | LOJPYUFGOCWEHF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(=O)c2ccc(Cl)c(C)c2[nH]1 |
|---|
Safety Information
| Symbol | GHS05, GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H318 |
|---|
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| RIDADR | UN 2811 6.1 / PGIII |
|---|
| HS Code | 2933499090 |
|---|
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 4(1H)-Quinolinone, 7-chloro-2,8-dimethyl- |
| 7-chloro-2,8-dimethylquinolin-4-ol |
| 7-Chloro-2,8-dimethyl-4(1H)-quinolinone |
| 4-quinolinol, 7-chloro-2,8-dimethyl- |
| 7-Chloro-2,8-dimethyl-4-quinolinol |
| 7-Chloro-2,8-dimethyl-4-hydroxyquinoline |