Introduction:Basic information about CAS 680596-79-6|1,4-Dioxaspiro[4,5]dec-7-en-8-boronic acid pinacol ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,4-Dioxaspiro[4,5]dec-7-en-8-boronic acid pinacol ester |
|---|
| CAS Number | 680596-79-6 | Molecular Weight | 266.141 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 313.9±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H23BO4 | Melting Point | 60-62ºC |
|---|
| MSDS | / | Flash Point | 143.7±30.7 °C |
|---|
Names
| Name | 2-(1,4-dioxaspiro[4.5]dec-7-en-8-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 313.9±52.0 °C at 760 mmHg |
|---|
| Melting Point | 60-62ºC |
|---|
| Molecular Formula | C14H23BO4 |
|---|
| Molecular Weight | 266.141 |
|---|
| Flash Point | 143.7±30.7 °C |
|---|
| Exact Mass | 266.168945 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 2.47120 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | JCHWHOHZZYWUMP-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)OB(C2=CCC3(CC2)OCCO3)OC1(C)C |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| 3-Cyanoprop-1-ylboronic acid,pinacol ester |
| pinacol selenite |
| 3-cyano-1-propylboronic acid pinacol ester |
| 4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-butanenitrile |
| Pinacolselenit |
| O,O'-seleninyl-pinacol |
| 4,4,5,5-tetramethyl-1,3-dioxa-2-selena-cyclopentane-2-oxide |
| 1,4-Dioxaspiro[4,5]dec-7-en-8-boronic acid pinacol ester |