Introduction：Basic information about CAS 75453-82-6|1-(2-aminoethyl)-3-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-aminoethyl)-3-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)thiourea |
|---|
| CAS Number | 75453-82-6 | Molecular Weight | 449.47900 |
|---|
| Density | 1.61g/cm3 | Boiling Point | 727.4ºC at 760 mmHg |
|---|
| Molecular Formula | C23H19N3O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 393.7ºC |
|---|
Names
| Name | 1-(2-aminoethyl)-3-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)thiourea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.61g/cm3 |
|---|
| Boiling Point | 727.4ºC at 760 mmHg |
|---|
| Molecular Formula | C23H19N3O5S |
|---|
| Molecular Weight | 449.47900 |
|---|
| Flash Point | 393.7ºC |
|---|
| Exact Mass | 449.10500 |
|---|
| PSA | 158.16000 |
|---|
| LogP | 4.07510 |
|---|
| Index of Refraction | 1.806 |
|---|
| InChIKey | VWLAGVVQCMHHJW-UHFFFAOYSA-N |
|---|
| SMILES | NCCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
|---|
Synonyms
| FEDA |
| Fluorescein thiocarbamylethylenediamine |
| Fluorescein ethylenediamine |
