Introduction:Basic information about CAS 2081-08-5|4,4'-Ethylidenediphenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Ethylidenediphenol |
|---|
| CAS Number | 2081-08-5 | Molecular Weight | 214.260 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 375.7±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H12O2 | Melting Point | 123-127ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 181.4±16.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 4-[1-(4-hydroxyphenyl)ethyl]phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 375.7±22.0 °C at 760 mmHg |
|---|
| Melting Point | 123-127ºC(lit.) |
|---|
| Molecular Formula | C14H12O2 |
|---|
| Molecular Weight | 214.260 |
|---|
| Flash Point | 181.4±16.9 °C |
|---|
| Exact Mass | 214.099380 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 3.08 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | HCNHNBLSNVSJTJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(c1ccc(O)cc1)c1ccc(O)cc1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2907299090 |
|---|
Customs
| HS Code | 2907299090 |
|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
|---|
Synonyms
| 1,1-Bis(4-hydroxyphenyl)ethane,Bisphenol |
| Bisphenol AD |
| Phenol, 4,4'-ethylidenebis- |
| Bisphenol E |
| 4,4'-Ethane-1,1-diyldiphenol |
| 4,4'-Ethylidenebisphenol |
| 4,4'-(1,1-Ethanediyl)diphenol |
| MFCD00186869 |
| 1,1-Bis(4-hydroxyphenyl)ethane |
| 4,4'-Ethylidenediphenol |