Introduction：Basic information about CAS 306935-77-3|4-(2,6-diethylanilino)-4-oxobut-2-enoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2,6-diethylanilino)-4-oxobut-2-enoic acid |
|---|
| CAS Number | 306935-77-3 | Molecular Weight | 247.29000 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 456.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H17NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 229.7ºC |
|---|
Names
| Name | 4-(2,6-diethylanilino)-4-oxobut-2-enoic acid |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 456.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H17NO3 |
|---|
| Molecular Weight | 247.29000 |
|---|
| Flash Point | 229.7ºC |
|---|
| Exact Mass | 247.12100 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.46370 |
|---|
| Index of Refraction | 1.588 |
|---|
| InChIKey | HPUZNWHASPOJPF-CMDGGOBGSA-N |
|---|
| SMILES | CCc1cccc(CC)c1NC(=O)C=CC(=O)O |
|---|
