Introduction:Basic information about CAS 20676-54-4|methyl 2-acetamido-5-chlorobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 2-acetamido-5-chlorobenzoate |
|---|
| CAS Number | 20676-54-4 | Molecular Weight | 227.64400 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 409ºC at 760mmHg |
|---|
| Molecular Formula | C10H10ClNO3 | Melting Point | 126-130 °C(lit.) |
|---|
| MSDS | USA | Flash Point | 201.2ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | methyl 2-acetamido-5-chlorobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 409ºC at 760mmHg |
|---|
| Melting Point | 126-130 °C(lit.) |
|---|
| Molecular Formula | C10H10ClNO3 |
|---|
| Molecular Weight | 227.64400 |
|---|
| Flash Point | 201.2ºC |
|---|
| Exact Mass | 227.03500 |
|---|
| PSA | 55.40000 |
|---|
| LogP | 2.15800 |
|---|
| Vapour Pressure | 6.71E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | TVAAIYFBEWHVCV-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(Cl)ccc1NC(C)=O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-Acetamido-5-chlorobenzoic Acid Methyl Ester |
| N-Acetyl-5-chlor-anthranilsaeure-methylester |
| MFCD00144759 |
| Methyl 2-AcetaMido-5-chlorobenzoate |
| 2-Acetylamino-5-chlor-benzoesaeure-methylester |
| Methyl N-Acetyl-5-chloroanthranilate |
| 2-Acetamino-5-chlor-benzoesaeure-methylester |
| N-Acetyl-5-chloroanthranilic Acid Methyl Ester |
| 5-Chlor-2-acetamino-benzoesaeure-methylester |