Introduction：Basic information about CAS 51584-18-0|(1-Methyl-1H-indol-3-yl)(oxo)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1-Methyl-1H-indol-3-yl)(oxo)acetic acid |
|---|
| CAS Number | 51584-18-0 | Molecular Weight | 203.194 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 391.0±24.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H9NO3 | Melting Point | 157-162ºC(lit.) |
|---|
| MSDS | / | Flash Point | 190.2±22.9 °C |
|---|
Names
| Name | 2-(1-methylindol-3-yl)-2-oxoacetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 391.0±24.0 °C at 760 mmHg |
|---|
| Melting Point | 157-162ºC(lit.) |
|---|
| Molecular Formula | C11H9NO3 |
|---|
| Molecular Weight | 203.194 |
|---|
| Flash Point | 190.2±22.9 °C |
|---|
| Exact Mass | 203.058243 |
|---|
| PSA | 59.30000 |
|---|
| LogP | 1.01 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.623 |
|---|
| InChIKey | UJQAQVXJQOQUEK-UHFFFAOYSA-N |
|---|
| SMILES | Cn1cc(C(=O)C(=O)O)c2ccccc21 |
|---|
Safety Information
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-27-36/37/39-45 |
|---|
| RIDADR | UN 1759 8/PG 2 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| N-Methyl-3-indoleglyoxylic acid |
| I10-0841 |
| MFCD02683552 |
| (1-Methyl-1H-indol-3-yl)(oxo)acetic acid |
| 1H-Indole-3-acetic acid, 1-methyl-α-oxo- |
