Introduction：Basic information about CAS 144332-60-5|ZN -Me-Aib-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ZN -Me-Aib-OH |
|---|
| CAS Number | 144332-60-5 | Molecular Weight | 251.27800 |
|---|
| Density | 1.195±0.06 g/cm3(Predicted) | Boiling Point | 394.8±31.0 °C(Predicted) |
|---|
| Molecular Formula | C13H17NO4 | Melting Point | 135-138 ℃(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
Names
| Name | 2-methyl-2-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.195±0.06 g/cm3(Predicted) |
|---|
| Boiling Point | 394.8±31.0 °C(Predicted) |
|---|
| Melting Point | 135-138 ℃(lit.) |
|---|
| Molecular Formula | C13H17NO4 |
|---|
| Molecular Weight | 251.27800 |
|---|
| Exact Mass | 251.11600 |
|---|
| PSA | 66.84000 |
|---|
| LogP | 2.11820 |
|---|
| InChIKey | QCDSXBNEBTVGTP-UHFFFAOYSA-N |
|---|
| SMILES | CN(C(=O)OCc1ccccc1)C(C)(C)C(=O)O |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| MFCD00191898 |
| N-Cbz-N,2-dimethylalanine |
| Z-N-Me-Aib-OH |
| Z-N,2-Dimethylalanine |
