Introduction:Basic information about CAS 537-91-7|Megasul, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Megasul |
|---|
| CAS Number | 537-91-7 | Molecular Weight | 308.333 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 443.6±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H8N2O4S2 | Melting Point | 78-80 °C(lit.) |
|---|
| MSDS | / | Flash Point | 222.1±24.6 °C |
|---|
Names
| Name | Bis(3-nitrophenyl) disulfide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 443.6±30.0 °C at 760 mmHg |
|---|
| Melting Point | 78-80 °C(lit.) |
|---|
| Molecular Formula | C12H8N2O4S2 |
|---|
| Molecular Weight | 308.333 |
|---|
| Flash Point | 222.1±24.6 °C |
|---|
| Exact Mass | 307.992554 |
|---|
| PSA | 142.24000 |
|---|
| LogP | 4.06 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.718 |
|---|
| InChIKey | ODOFDWDUSSFUMN-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc(SSc2cccc([N+](=O)[O-])c2)c1 |
|---|
Safety Information
| Hazard Codes | N:Dangerousfortheenvironment; |
|---|
| Risk Phrases | R50/53 |
|---|
| Safety Phrases | S60-S61 |
|---|
| RIDADR | UN 3077 9/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | JO1550000 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2930909090 |
|---|
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Bis(m-nitrophenyl) disulfide |
| Bis(3-nitrophenyl) Disulfide |
| 3-Nitrophenyl disulfide |
| Megasul |
| NITROPHENIDE |
| 1,1'-Disulfanediylbis(3-nitrobenzene) |
| Disulfide, bis(3-nitrophenyl) |
| Disulfide, bis(m-nitrophenyl) (8CI) |
| m,m'-Dinitrodiphenyl disulfide |
| Bis(3-nitrophenyl)disulfide |
| Disulfide, bis(m-nitrophenyl) |
| 1-nitro-3-[(3-nitrophenyl)disulfanyl]benzene |
| MFCD00003573 |
| 3,3'-Dinitrodiphenyl disulfide |
| EINECS 208-677-6 |