Introduction：Basic information about CAS 1944-05-4|2,3,4,5,6-pentafluorobenzhydrol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3,4,5,6-pentafluorobenzhydrol |
|---|
| CAS Number | 1944-05-4 | Molecular Weight | 274.18600 |
|---|
| Density | / | Boiling Point | 115 °C |
|---|
| Molecular Formula | C13H7F5O | Melting Point | 54 °C |
|---|
| MSDS | / | Flash Point | >110°C |
|---|
Names
| Name | (2,3,4,5,6-pentafluorophenyl)-phenylmethanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 115 °C |
|---|
| Melting Point | 54 °C |
|---|
| Molecular Formula | C13H7F5O |
|---|
| Molecular Weight | 274.18600 |
|---|
| Flash Point | >110°C |
|---|
| Exact Mass | 274.04200 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 3.46380 |
|---|
| Vapour Pressure | 0.00154mmHg at 25°C |
|---|
| InChIKey | PMIIFKURPQGSMI-UHFFFAOYSA-N |
|---|
| SMILES | OC(c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S26-S36 |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| 2,3',4,4',6-PENTACB UNLABELED |
| 2,3,4,5,6-Pentafluorobenzhydrol |
| pentafluorophenylbenzyl alcohol |
| Phenyl-2,3,4,5,6-pentafluorphenylmethanol |
| 2,3,4,5,6-pentafluorobenzhydryl alcohol |
| MFCD00004489 |
| EINECS 217-741-2 |
