Introduction:Basic information about CAS 865-77-0|perfluoroisononyl iodide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | perfluoroisononyl iodide |
|---|
| CAS Number | 865-77-0 | Molecular Weight | 595.97000 |
|---|
| Density | 1.987 g/cm3 | Boiling Point | 190 °C |
|---|
| Molecular Formula | C9F19I | Melting Point | / |
|---|
| MSDS | / | Flash Point | 80.4ºC |
|---|
Names
| Name | 1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluoro-8-iodo-2-(trifluoromethyl)octane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.987 g/cm3 |
|---|
| Boiling Point | 190 °C |
|---|
| Molecular Formula | C9F19I |
|---|
| Molecular Weight | 595.97000 |
|---|
| Flash Point | 80.4ºC |
|---|
| Exact Mass | 595.87400 |
|---|
| LogP | 7.02360 |
|---|
| Index of Refraction | 1.32 |
|---|
| InChIKey | VRJGWRPPKVEMMR-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
|---|
Safety Information
| Hazard Codes | T: Toxic; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| PC6089A |
| 1-Iod-perfluoro-7-methyl-octan |
| 2H,8H-hexadecafluoro-8-iodo-2-trifluoromethyl-octane |
| Perfluoroisononyl iodide |
| MFCD00153243 |
| EINECS 212-747-1 |
| 7-methylperfluorooctyl iodide |