Introduction:Basic information about CAS 871716-68-6|(S)-Tert-Butyl2-(2-aminothiazol-4-yl)pyrrolidine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-Tert-Butyl2-(2-aminothiazol-4-yl)pyrrolidine-1-carboxylate |
|---|
| CAS Number | 871716-68-6 | Molecular Weight | 269.36300 |
|---|
| Density | 1.246g/cm3 | Boiling Point | 416.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.7ºC |
|---|
Names
| Name | (S)-Tert-Butyl2-(2-aminothiazol-4-yl)pyrrolidine-1-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.246g/cm3 |
|---|
| Boiling Point | 416.5ºC at 760 mmHg |
|---|
| Molecular Formula | C12H19N3O2S |
|---|
| Molecular Weight | 269.36300 |
|---|
| Flash Point | 205.7ºC |
|---|
| Exact Mass | 269.12000 |
|---|
| PSA | 96.69000 |
|---|
| LogP | 3.31640 |
|---|
| Index of Refraction | 1.58 |
|---|
| InChIKey | FENBXFSBJDNUKQ-SECBINFHSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1csc(N)n1 |
|---|