Introduction:Basic information about CAS 54941-44-5|2-(4-methyl-3-nitrophenyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-methyl-3-nitrophenyl)acetic acid |
|---|
| CAS Number | 54941-44-5 | Molecular Weight | 195.17200 |
|---|
| Density | 1.346g/cm3 | Boiling Point | 374.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.5ºC |
|---|
Names
| Name | 2-(4-methyl-3-nitrophenyl)acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.346g/cm3 |
|---|
| Boiling Point | 374.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9NO4 |
|---|
| Molecular Weight | 195.17200 |
|---|
| Flash Point | 166.5ºC |
|---|
| Exact Mass | 195.05300 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.05350 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | WZNKBDUWSKJHEG-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(CC(=O)O)cc1[N+](=O)[O-] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 3-nitro p-tolylacetic acid |
| CL4118 |
| 3-nitro-4-methylphenylacetic acid |
| 4-methyl-3-nitrophenylacetic acid |
| 3-Nitro-4-methyl-phenylessigsaeure |