Introduction：Basic information about CAS 67827-53-6|2-Propenoic acid,3-(2,4,6-trimethoxyphenyl)-, ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Propenoic acid,3-(2,4,6-trimethoxyphenyl)-, ethyl ester |
|---|
| CAS Number | 67827-53-6 | Molecular Weight | 266.29000 |
|---|
| Density | 1.114 g/cm3 | Boiling Point | 407.2ºC |
|---|
| Molecular Formula | C14H18O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 180.4ºC |
|---|
Names
| Name | ethyl (E)-3-(2,4,6-trimethoxyphenyl)prop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.114 g/cm3 |
|---|
| Boiling Point | 407.2ºC |
|---|
| Molecular Formula | C14H18O5 |
|---|
| Molecular Weight | 266.29000 |
|---|
| Flash Point | 180.4ºC |
|---|
| Exact Mass | 266.11500 |
|---|
| PSA | 53.99000 |
|---|
| LogP | 2.28870 |
|---|
| Index of Refraction | 1.525 |
|---|
| InChIKey | NGOZXDZLACOEPS-VOTSOKGWSA-N |
|---|
| SMILES | CCOC(=O)C=Cc1c(OC)cc(OC)cc1OC |
|---|
Synonyms
| Ethyl 2,6-trimethoxycinnamate |
| 2,4,6-trimethoxy-trans-cinnamic acid ethyl ester |
| Ethyl 2,4,6-trimethoxycinnamate |
