Introduction:Basic information about CAS 26693-55-0|(-)-cis-2-benzamidocyclohexanecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (-)-cis-2-benzamidocyclohexanecarboxylic acid |
|---|
| CAS Number | 26693-55-0 | Molecular Weight | 247.29000 |
|---|
| Density | 1.21g/cm3 | Boiling Point | 506.1ºC at 760mmHg |
|---|
| Molecular Formula | C14H17NO3 | Melting Point | 205-209ºC(lit.) |
|---|
| MSDS | / | Flash Point | 259.9ºC |
|---|
Names
| Name | (-)-cis-2-benzamidocyclohexanecarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21g/cm3 |
|---|
| Boiling Point | 506.1ºC at 760mmHg |
|---|
| Melting Point | 205-209ºC(lit.) |
|---|
| Molecular Formula | C14H17NO3 |
|---|
| Molecular Weight | 247.29000 |
|---|
| Flash Point | 259.9ºC |
|---|
| Exact Mass | 247.12100 |
|---|
| PSA | 66.40000 |
|---|
| LogP | 2.45070 |
|---|
| Vapour Pressure | 4.59E-11mmHg at 25°C |
|---|
| Index of Refraction | -36.5 ° (C=0.5, EtOH) |
|---|
| InChIKey | PUANNVQABXUYKU-NEPJUHHUSA-M |
|---|
| SMILES | O=C(NC1CCCCC1C(=O)[O-])c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 37/39-26 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,3-Dihydroflavonol |
| 2,3-Dihydro-3-hydroxy-2-phenyl-4H-1-benzopyran-4-one |
| (1R,2S)-(-)-2-BENZAMIDOCYCLOHEXANECARBOXYLIC ACID |
| (-)-cis-2-Benzamidocyclohexanecarboxylic Acid |
| Flavanonol |
| 3-hydroxy-2-phenyl-chroman-4-one |
| MFCD00078309 |
| 2-Phenyl-3-hydroxy-2,3-dihydro-4H-1-benzopyran-4-one |
| HYDROXYFLAVANONE,3' |
| 3-hydroxyflavanone |
| trans-2-benzoylamino-1-cyclohexanecarboxylic acid |
| (1R,2S)-2-Benzamidocyclohexanecarboxylic acid |
| 2-aminocyclohexanecarboxylic acid |
| rac-trans-3-hydroxy-2-phenyl-3,4-dihydro-2H-chromen-4-one |
| N-benzoyl-trans-2-aminocyclohexanecarboxylic acid |
| 2,3-trans-3-Hydroxyflavanone |
| N-benzoyl-trans-2-amino-1-cyclohexanecarboxylic acid |