Introduction：Basic information about CAS 910-86-1|Thiocarlide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Thiocarlide |
|---|
| CAS Number | 910-86-1 | Molecular Weight | 400.577 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 508.5±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C23H32N2O2S | Melting Point | 134-145° |
|---|
| MSDS | / | Flash Point | 261.3±32.9 °C |
|---|
Names
| Name | 1,3-bis[4-(3-methylbutoxy)phenyl]thiourea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 508.5±60.0 °C at 760 mmHg |
|---|
| Melting Point | 134-145° |
|---|
| Molecular Formula | C23H32N2O2S |
|---|
| Molecular Weight | 400.577 |
|---|
| Flash Point | 261.3±32.9 °C |
|---|
| Exact Mass | 400.218445 |
|---|
| PSA | 74.61000 |
|---|
| LogP | 6.12 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.600 |
|---|
| InChIKey | BWBONKHPVHMQHE-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)CCOc1ccc(NC(=S)Nc2ccc(OCCC(C)C)cc2)cc1 |
|---|
Synonyms
| Tiocarlida |
| 4-13-00-01187 (Beilstein Handbook Reference) |
| Sarbamyl |
| Thiocarlide |
| 1,3-Bis(p-isoamyloxyphenyl)-2-thiourea |
| 4,4'-Di(isoamyloxy)thiocarbanilide |
| Amixyl |
| Tiocarlid |
| DATC |
| Thiourea, N,N'-bis[4-(3-methylbutoxy)phenyl]- |
| Thiourea, N,N'-bis(4-(3-methylbutoxy)phenyl)- |
| 1,3-Bis[4-(3-methylbutoxy)phenyl]thiourea |
| Thiourea, N,N'-bis(4-(3-methylbutoxy)phenyl)- (9CI) |
| Tiocarlidum |
| Disoxyl |
| tiocarlide |
| N,N'-[4-(3-Methylbutoxy)phenyl]thiourea |
| Isoxyl |
