Introduction：Basic information about CAS 1197953-49-3|2,5-dichloro-N-(2-(diMethylphosphoryl)phenyl)pyriMidin-4-aMine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-dichloro-N-(2-(diMethylphosphoryl)phenyl)pyriMidin-4-aMine |
|---|
| CAS Number | 1197953-49-3 | Molecular Weight | 316.123 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 527.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H12Cl2N3OP | Melting Point | / |
|---|
| MSDS | / | Flash Point | 272.8±30.1 °C |
|---|
Names
| Name | 4-(orthodimethylphosphinylanilino)-5-chloro-2-chloropyrimidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 527.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H12Cl2N3OP |
|---|
| Molecular Weight | 316.123 |
|---|
| Flash Point | 272.8±30.1 °C |
|---|
| Exact Mass | 315.009491 |
|---|
| PSA | 64.69000 |
|---|
| LogP | 1.50 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | XIKUAKVCJMVXCI-UHFFFAOYSA-N |
|---|
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Cl)ncc1Cl |
|---|
Synonyms
| AP26113intermediate |
| 4-(ortho dimethyl phosphinyl anilino)-5-chloro-2-chloro pyrimidine |
| 4-Pyrimidinamine, 2,5-dichloro-N-[2-(dimethylphosphinyl)phenyl]- |
| 2,5-Dichloro-N-[2-(dimethylphosphoryl)phenyl]-4-pyrimidinamine |
| 2,5-dichloro-N-(2-(diMethylphosphoryl)phenyl)pyriMidin-4-aMine |
