Introduction：Basic information about CAS 511529-00-3|5-bromo-N-(tert-butyl)-2-Methylbenzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-bromo-N-(tert-butyl)-2-Methylbenzenesulfonamide |
|---|
| CAS Number | 511529-00-3 | Molecular Weight | 306.219 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 384.3±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H16BrNO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 186.2±30.7 °C |
|---|
Names
| Name | N-tert-butyl-2-methyl-5-bromobenzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 384.3±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H16BrNO2S |
|---|
| Molecular Weight | 306.219 |
|---|
| Flash Point | 186.2±30.7 °C |
|---|
| Exact Mass | 305.008514 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 3.80 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | AHUXEFWSXHFQIP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)NC(C)(C)C |
|---|
Synonyms
| Benzenesulfonamide, 5-bromo-N-(1,1-dimethylethyl)-2-methyl- |
| 5-bromo-N-(tert-butyl)-2-methylbenzenesulfonamide |
| 5-bromo-N-tert-butyl-2-methyl-benzenesulfonamide |
| 5-Bromo-2-methyl-N-(2-methyl-2-propanyl)benzenesulfonamide |
