Introduction：Basic information about CAS 53911-36-7|4-tert-butyl-2-phenylpyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-tert-butyl-2-phenylpyridine |
|---|
| CAS Number | 53911-36-7 | Molecular Weight | 211.302 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 330.8±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H17N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 139.7±14.8 °C |
|---|
Names
| Name | 4-(tert-butyl)-2-phenylpyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 330.8±21.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H17N |
|---|
| Molecular Weight | 211.302 |
|---|
| Flash Point | 139.7±14.8 °C |
|---|
| Exact Mass | 211.136093 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.32 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.540 |
|---|
| InChIKey | HJEZZKLAFQYBOS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1ccnc(-c2ccccc2)c1 |
|---|
Synonyms
| 4-(1,1-diMethylethyl)-2 -phenyl-pyridine |
| Pyridine, 4-(1,1-dimethylethyl)-2-phenyl- |
| 4-t-butyl-2-phenylpyridine |
| 4-tert-butyl-2-phenylpyridine |
| 4-tert.-Butyl-2-phenylpyridin |
| 4-(2-Methyl-2-propanyl)-2-phenylpyridine |
