Introduction：Basic information about CAS 903878-29-5|{3-[3-(Diethylamino)propoxy]phenyl}boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | {3-[3-(Diethylamino)propoxy]phenyl}boronic acid |
|---|
| CAS Number | 903878-29-5 | Molecular Weight | 251.130 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 413.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H22BNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.0±31.5 °C |
|---|
Names
| Name | 3-(3-diethylaminopropoxy)phenylboronic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 413.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H22BNO3 |
|---|
| Molecular Weight | 251.130 |
|---|
| Flash Point | 204.0±31.5 °C |
|---|
| Exact Mass | 251.169281 |
|---|
| PSA | 52.93000 |
|---|
| LogP | 2.49 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | QAJMGDFXUWOLEU-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCCOc1cccc(B(O)O)c1 |
|---|
| Storage condition | 2-8°C |
|---|
Synonyms
| (3-(3-(diethylamino)propoxy)phenyl)boronic acid |
| Boronic acid, B-[3-[3-(diethylamino)propoxy]phenyl]- |
| 3-(3-diethylaminopropyl)phenyl boronic acid |
| {3-[3-(Diethylamino)propoxy]phenyl}boronic acid |
