Introduction：Basic information about CAS 864070-37-1|Empagliflozin Impurity 7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Empagliflozin Impurity 7 |
|---|
| CAS Number | 864070-37-1 | Molecular Weight | 380.819 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 628.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H21ClO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 333.8±31.5 °C |
|---|
Names
| Name | (2S,3R,4R,5S,6R)-2-(4-chloro-3-(4-hydroxybenzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 628.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H21ClO6 |
|---|
| Molecular Weight | 380.819 |
|---|
| Flash Point | 333.8±31.5 °C |
|---|
| Exact Mass | 380.102661 |
|---|
| PSA | 110.38000 |
|---|
| LogP | 3.24 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.659 |
|---|
| InChIKey | ODQAIMBPQWETBE-FQBWVUSXSA-N |
|---|
| SMILES | OCC1OC(c2ccc(Cl)c(Cc3ccc(O)cc3)c2)C(O)C(O)C1O |
|---|
Synonyms
| D-Glucitol, 1,5-anhydro-1-C-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]-, (1S)- |
| 1-chloro-4-(β-D-glucopyranosyl)-2-(4-hydroxybenzyl)benzene |
| BMS-511926 |
| 1-chloro-4-(β-D-glucopyranos-1-yl)-2-(4-hydroxybenzyl)-benzene |
| 1-chloro-4-(β-D-glucopyranos-1-yl)-2-(4-hydroxybenzyl)benzene |
| 1-chloro-4-(β-D-qlucopyranos-1-yl)-2-(4-hydroxybenzyl)-benzene |
| (1S)-1,5-Anhydro-1-[4-chloro-3-(4-hydroxybenzyl)phenyl]-D-glucitol |
| 1-chloro-4-(β-D-glucopyranos-1-yl)-2-(4-hydroxy-benzyl)-benzene |
| Empagliflozin Impurity 7 |
