Introduction:Basic information about CAS 117580-24-2|3-Mercaptopropionyl-Tyr-D-Trp-Lys-Val-Cys-Phe-NH2, (Disulfide bond between Deamino-C, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Mercaptopropionyl-Tyr-D-Trp-Lys-Val-Cys-Phe-NH2, (Disulfide bond between Deamino-Cys1 and Cys6) |
|---|
| CAS Number | 117580-24-2 | Molecular Weight | 930.146 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 1358.0±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C46H59N9O8S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 775.1±34.3 °C |
|---|
Names
| Name | 3-Mercaptopropionyl-Tyr-D-Trp-Lys-Val-Cys-Phe-NH2 |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 1358.0±65.0 °C at 760 mmHg |
|---|
| Molecular Formula | C46H59N9O8S2 |
|---|
| Molecular Weight | 930.146 |
|---|
| Flash Point | 775.1±34.3 °C |
|---|
| Exact Mass | 929.392822 |
|---|
| LogP | 2.28 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.592 |
|---|
| InChIKey | UUCIBIYNEVFSQS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(NC(=O)C(CCCCN)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1ccc(O)cc1)NC(=O)CCS)C(=O)NC(CS)C(=O)NC(Cc1ccccc1)C(N)=O |
|---|
Synonyms
| 1,2-Dithia-5,8,11,14,17-pentaazacycloeicosane, cyclic peptide deriv |
| N-(3-Mercapto-1-oxopropyl)-L-tyrosyl-D-tryptophyl-L-lysyl-L-valyl-L-cysteinyl-L-phenylalaninamide cyclic (1→5)-disulfide |
| 1,2-Dithia-5,8,11,14,17-pentaazacycloeicosane-4-carboxamide, 10-(4-aminobutyl)-N-[(1S)-2-amino-2-oxo-1-(phenylmethyl)ethyl]-16-[(4-hydroxyphenyl)methyl]-13-(1H-indol-3-ylmethyl)-7-(1-methylethyl)-6,9,12,15,18-pentaoxo-, (4R,7S,10S,13R,16S)- |
| (4R,7S,10S,13R,16S)-10-(4-Aminobutyl)-N-[(2S)-1-amino-1-oxo-3-phenyl-2-propanyl]-16-(4-hydroxybenzyl)-13-(1H-indol-3-ylmethyl)-7-isopropyl-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosane-4-carboxamide |
| BIM 23030 |