Introduction:Basic information about CAS 83880-70-0|dexamethasone acefurate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dexamethasone acefurate |
|---|
| CAS Number | 83880-70-0 | Molecular Weight | 528.566 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 649.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C29H33FO8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 346.4±31.5 °C |
|---|
Names
| Name | 9α-fluoro-16α-methyl-11β,17α,21-trihydroxy-1,4-pregnadiene-3,20-dione 17-(2'-furoate) 21-acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 649.1±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C29H33FO8 |
|---|
| Molecular Weight | 528.566 |
|---|
| Flash Point | 346.4±31.5 °C |
|---|
| Exact Mass | 528.215942 |
|---|
| PSA | 120.11000 |
|---|
| LogP | 4.17 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.580 |
|---|
| InChIKey | DDIWRLSEGOVQQD-BJRLRHTOSA-N |
|---|
| SMILES | CC(=O)OCC(=O)C1(OC(=O)c2ccco2)C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)CC21C |
|---|
Synonyms
| (11b,16a)-21-(Acetyloxy)-9-fluoro-17-((2-furanylcarbonyl)oxy)-11-hydroxy-16-methylpregna-1,4-diene-3,20-dione |
| (11β,16α)-21-Acetoxy-9-fluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-dien-17-yl 2-furoate |
| 2-Furancarboxylic acid, (11β,16α)-21-(acetyloxy)-9-fluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-dien-17-yl ester |
| 9-Fluoro-11β,17,21-trihydroxy-16α-methylpregna-1,4-diene-3,20-dione 21-acetate 17-(2-furaoate) |
| (11β,16α)-21-(acetyloxy)-9-fluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-dien-17-yl furan-2-carboxylate |
| 9-Fluoro-11b,17,21-trihydroxy-16a-methylpregna-1,4-diene-3,20-dione 21-Acetate 17-(2-Furaoate) |
| dexamethasone acefurate |