Introduction:Basic information about CAS 199454-06-3|Carbamic acid, (2-ethynylphenyl)-, 1,1-dimethylethyl ester (9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Carbamic acid, (2-ethynylphenyl)-, 1,1-dimethylethyl ester (9CI) |
|---|
| CAS Number | 199454-06-3 | Molecular Weight | 217.264 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 272.7±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H15NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 118.7±22.6 °C |
|---|
Names
| Name | N-Boc-2-ethynylaniline |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 272.7±23.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H15NO2 |
|---|
| Molecular Weight | 217.264 |
|---|
| Flash Point | 118.7±22.6 °C |
|---|
| Exact Mass | 217.110275 |
|---|
| PSA | 38.33000 |
|---|
| LogP | 3.18 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.534 |
|---|
| InChIKey | AFAKFBOLEVUSDT-UHFFFAOYSA-N |
|---|
| SMILES | C#Cc1ccccc1NC(=O)OC(C)(C)C |
|---|
Synonyms
| urethane |
| Carbamic acid, N-(2-ethynylphenyl)-, 1,1-dimethylethyl ester |
| Carbamic acid,(2-ethynylphenyl)-,1,1-dimethyl ethyl ester |
| (2-ethynylphenyl)carbamic acid 1,1-dimethylethyl ester |
| N-Boc-o-ethynylaniline |
| 2-Methyl-2-propanyl (2-ethynylphenyl)carbamate |
| Carbamicacid,(2-ethynylphenyl)-,1,1-dimethyl ethylester(9CI) |