Introduction：Basic information about CAS 21410-51-5|O-[3-chloro-4-(diethylsulfamoyl)phenyl] O,O-dimethyl phosphorothioate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | O-[3-chloro-4-(diethylsulfamoyl)phenyl] O,O-dimethyl phosphorothioate |
|---|
| CAS Number | 21410-51-5 | Molecular Weight | 387.84000 |
|---|
| Density | 1.359g/cm3 | Boiling Point | 448.7°C at 760 mmHg |
|---|
| Molecular Formula | C12H19ClNO5PS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225.2°C |
|---|
Names
| Name | O-[3-chloro-4-(diethylsulfamoyl)phenyl] O,O-dimethyl phosphorothioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.359g/cm3 |
|---|
| Boiling Point | 448.7°C at 760 mmHg |
|---|
| Molecular Formula | C12H19ClNO5PS2 |
|---|
| Molecular Weight | 387.84000 |
|---|
| Flash Point | 225.2°C |
|---|
| Exact Mass | 387.01300 |
|---|
| PSA | 115.35000 |
|---|
| LogP | 4.99800 |
|---|
| Index of Refraction | 1.551 |
|---|
| InChIKey | BASLHEYUURTCNQ-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OP(=S)(OC)OC)cc1Cl |
|---|
Synonyms
| Phosphorothioic acid, O-[3-chloro-4-[(diethylamino)sulfonyl]phenyl] O,O-dimethyl ester |
| AI 3-27769 |
| IC |
| O,O-Dimethyl O-(4-(N,N-diethylsulfamoyl)-3-chlorophenyl) phosphorothioate |
| Phosphorothioic acid, O-(3-chloro-4-((diethylamino)sulfonyl)phenyl) O,O-dimethyl ester |
| Phosphorothioic acid, O,O-dimethyl ester, O-ester with 2-chloro-N,N-diethyl-4-hydroxybenzenesulfonamide |
