Introduction：Basic information about CAS 214557-89-8|3,5,7-Trifluoro-1-adamantanecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5,7-Trifluoro-1-adamantanecarboxylic acid |
|---|
| CAS Number | 214557-89-8 | Molecular Weight | 234.215 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 304.3±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13F3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137.9±27.9 °C |
|---|
Names
| Name | 3,5,7-trifluoroadamantane-1-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 304.3±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H13F3O2 |
|---|
| Molecular Weight | 234.215 |
|---|
| Flash Point | 137.9±27.9 °C |
|---|
| Exact Mass | 234.086761 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 1.00 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.501 |
|---|
| InChIKey | QBRDOUHHJWRTHN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C12CC3(F)CC(F)(CC(F)(C3)C1)C2 |
|---|
Synonyms
| 3,5,7-Trifluoro-adamantane-1-carboxylic acid |
| 3,5,7-Trifluoro-1-adamantanecarboxylic acid |
| Tricyclo[3.3.1.1]decane-1-carboxylic acid, 3,5,7-trifluoro- |
