Introduction：Basic information about CAS 114747-48-7|Spiro[2H-indole-2,3'-[3H]naphth[2,1-b][1,4]oxazine], 1,3-dihydro-1,3,3-triMethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Spiro[2H-indole-2,3'-[3H]naphth[2,1-b][1,4]oxazine], 1,3-dihydro-1,3,3-triMethyl-6'-(4-Morpholinyl)- |
|---|
| CAS Number | 114747-48-7 | Molecular Weight | 413.512 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 652.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H27N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 348.5±31.5 °C |
|---|
Names
| Name | 1,3,3-trimethyl-6'-morpholinospiro(indoline-2,3'-3H-naphtho[2,1-b][1,4]-oxazine) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 652.7±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C26H27N3O2 |
|---|
| Molecular Weight | 413.512 |
|---|
| Flash Point | 348.5±31.5 °C |
|---|
| Exact Mass | 413.210327 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.54 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.664 |
|---|
| InChIKey | VBGVMVBBKHCPIQ-UHFFFAOYSA-N |
|---|
| SMILES | CN1c2ccccc2C(C)(C)C12C=Nc1c(cc(N3CCOCC3)c3ccccc13)O2 |
|---|
Synonyms
| 1,3,3-trimethyl-6-(4-morpholino)spiro{indolino-2,3'-[3H]naphtho[2,1-b]oxazine} |
| 6'-Morpholino-1,3,3-trimethylspiro(indoline-2,3'-[3H]naphth[2,1-b][1,4]oxazine) |
| 1,3,3-trimethyl-6'-(morpholin-4-yl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] |
| Spiro[2H-indole-2,3'-[3H]naphth[2,1-b][1,4]oxazine], 1,3-dihydro-1,3,3-trimethyl-6'-(4-morpholinyl)- |
| 1,3,3-Trimethyl-6'-(4-morpholinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] |
| 1,3,3-trimethyl-6'-morpholinospiro(indoline-2,3'-naphtho[2,1-b][1,4]oxazine) |
| 1,3,3-trimethyl-6'-morpholinospiro(indolino-2,3'-[3H]naphth[2,1-b]oxazine) |
