Introduction:Basic information about CAS 1256393-27-7|ledipasvir interMediate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ledipasvir interMediate |
|---|
| CAS Number | 1256393-27-7 | Molecular Weight | 831.948 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C47H51F2N7O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-[6-(9,9-difluoro-7-{2-[5-(2-methoxycarbonylamino-3-methyl-butyryl)-5-aza-spiro[2.4]hept-6-yl]-3H-imidazol-4-yl}-9H-fluoren-2-yl)-1H-benzoimidazol-2-yl]-2-aza-bicyclo[2.2.1]heptane-2-carboxylic acid tert-butyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Molecular Formula | C47H51F2N7O5 |
|---|
| Molecular Weight | 831.948 |
|---|
| Exact Mass | 831.391968 |
|---|
| PSA | 145.54000 |
|---|
| LogP | 6.91 |
|---|
| Index of Refraction | 1.681 |
|---|
| InChIKey | BFGOURKCVBTGRQ-RLNHTXKNSA-N |
|---|
| SMILES | COC(=O)NC(C(=O)N1CC2(CC2)CC1c1ncc(-c2ccc3c(c2)C(F)(F)c2cc(-c4ccc5nc(C6C7CCC(C7)N6C(=O)OC(C)(C)C)[nH]c5c4)ccc2-3)[nH]1)C(C)C |
|---|
Synonyms
| 2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 3-[6-[9,9-difluoro-7-[2-[(6S)-5-[(2S)-2-[(methoxycarbonyl)amino]-3-methyl-1-oxobutyl]-5-azaspiro[2.4]hept-6-yl]-1H-imidazol-5-yl]-9H-fluoren-2-yl]-1H-benzimidazol-2-yl]-, 1,1-dimethylethyl ester, (1R,3S,4S)- |
| 2-Methyl-2-propanyl (1R,3S,4S)-3-{6-[9,9-difluoro-7-(2-{(6S)-5-[N-(methoxycarbonyl)-L-valyl]-5-azaspiro[2.4]hept-6-yl}-1H-imidazol-5-yl)-9H-fluoren-2-yl]-1H-benzimidazol-2-yl}-2-azabicyclo[2.2.1]heptane-2-carboxylate |