Introduction：Basic information about CAS 1472062-94-4|2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine |
|---|
| CAS Number | 1472062-94-4 | Molecular Weight | 343.809 |
|---|
| Density | 1.241±0.06 g/cm3 | Boiling Point | 571.6±43.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H14ClN3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 328.4±13.8 °C |
|---|
Names
| Name | 2-(4-Biphenylyl)-4-chloro-6-phenyl-1,3,5-triazine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.241±0.06 g/cm3 |
|---|
| Boiling Point | 571.6±43.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H14ClN3 |
|---|
| Molecular Weight | 343.809 |
|---|
| Flash Point | 328.4±13.8 °C |
|---|
| Exact Mass | 343.087616 |
|---|
| LogP | 6.01 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | JKHCVYDYGWHIFJ-UHFFFAOYSA-N |
|---|
| SMILES | Clc1nc(-c2ccccc2)nc(-c2ccc(-c3ccccc3)cc2)n1 |
|---|
| Water Solubility | Insuluble (5.8E-5 g/L) (25 ºC) |
|---|
Synonyms
| 2-(4-Biphenylyl)-4-chloro-6-phenyl-1,3,5-triazine |
| 1,3,5-Triazine, 2-[1,1'-biphenyl]-4-yl-4-chloro-6-phenyl- |
| 2-(4-Biphénylyl)-4-chloro-6-phényl-1,3,5-triazine |
| 2-(4-Biphenylyl)-4-chlor-6-phenyl-1,3,5-triazin |
| 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine |
| 2-chloro-4-(biphenyl-4-yl)-6-phenyl-1,3,5-triazine |
| 2-[1,1'-Biphenyl]-4-yl-4-chloro-6-phenyl-1,3,5-triazine |
