Introduction：Basic information about CAS 116724-13-1|trans-1,3-cyclohexanedicarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trans-1,3-cyclohexanedicarboxylic acid |
|---|
| CAS Number | 116724-13-1 | Molecular Weight | 172.178 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 332.4±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 169.0±19.7 °C |
|---|
Names
| Name | 1,3-Cyclohexanedicarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 332.4±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H12O4 |
|---|
| Molecular Weight | 172.178 |
|---|
| Flash Point | 169.0±19.7 °C |
|---|
| Exact Mass | 172.073563 |
|---|
| LogP | 0.46 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.521 |
|---|
| InChIKey | SIUPRLJMTTYZLD-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1CCC(C(=O)O)C1.O=C(O)C1CCC(C(=O)O)C1 |
|---|
Synonyms
| 1,3-Cyclohexanedicarboxylic acid |
| cyclohexane-1,3-dicarboxylic acid |
| trans-1,3-cyclohexanedicarboxylic acid |
