Introduction：Basic information about CAS 1185144-74-4|Olmesartan-d6 Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Olmesartan-d6 Acid |
|---|
| CAS Number | 1185144-74-4 | Molecular Weight | 446.502 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 738.3±70.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H26N6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 400.3±35.7 °C |
|---|
Names
| Name | Olmesartan |
|---|
| Synonym | More Synonyms |
|---|
Olmesartan-d6 Acid BiologicalActivity
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 738.3±70.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H26N6O3 |
|---|
| Molecular Weight | 446.502 |
|---|
| Flash Point | 400.3±35.7 °C |
|---|
| Exact Mass | 446.206635 |
|---|
| LogP | 3.72 |
|---|
| Vapour Pressure | 0.0±2.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.671 |
|---|
| InChIKey | VTRAEEWXHOVJFV-XERRXZQWSA-N |
|---|
| SMILES | CCCc1nc(C(C)(C)O)c(C(=O)O)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
|---|
Synonyms
| 4-(2-Hydroxy-2-propanyl)-2-propyl-1-{[2'-(1H-tetrazol-5-yl)-4-biphenylyl]methyl}-1H-imidazole-5-carboxylic acid |
| MFCD09749896 |
| MFCD00914967 |
| Olmesartan |
| 8W1IQP3U10 |
| 1H-Imidazole-5-carboxylic acid, 4-(1-hydroxy-1-methylethyl)-2-propyl-1-[[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl]- |
