Introduction:Basic information about CAS 110078-47-2|1,1'-[1,4-Phenylenebis(methylene)]bis[4,8,11-tris[(4-methylphenyl)sulfonyl]-1,4,, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1'-[1,4-Phenylenebis(methylene)]bis[4,8,11-tris[(4-methylphenyl)sulfonyl]-1,4,8,11-tetraazacyclotetradecane |
|---|
| CAS Number | 110078-47-2 | Molecular Weight | 1427.900 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C70H90N8O12S6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,4,8,11-Tetraazacyclotetradecane, 1,1'-[1,4-phenylenebis(Methylene)]bis[4,8,11-tris[(4-Methylphenyl)sulfon yl]- |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C70H90N8O12S6 |
|---|
| Molecular Weight | 1427.900 |
|---|
| Exact Mass | 1426.500244 |
|---|
| LogP | 13.49 |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | DSYDEHAVVVQGIK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(S(=O)(=O)c3ccc(C)cc3)CCN(S(=O)(=O)c3ccc(C)cc3)CCCN(Cc3ccc(CN4CCCN(S(=O)(=O)c5ccc(C)cc5)CCN(S(=O)(=O)c5ccc(C)cc5)CCCN(S(=O)(=O)c5ccc(C)cc5)CC4)cc3)CC2)cc1 |
|---|