Introduction:Basic information about CAS 735-64-8|Fenamifuril, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fenamifuril |
|---|
| CAS Number | 735-64-8 | Molecular Weight | 279.289 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 462.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H17NO5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.5±20.9 °C |
|---|
Names
| Name | Fenamifuril |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 462.4±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H17NO5 |
|---|
| Molecular Weight | 279.289 |
|---|
| Flash Point | 222.5±20.9 °C |
|---|
| Exact Mass | 279.110687 |
|---|
| LogP | 0.13 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.545 |
|---|
| InChIKey | CNANHKGYHBTGAQ-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1ccccc1OCC(=O)OCC1CCCO1 |
|---|
Synonyms
| Acetic acid, 2-[2-(aminocarbonyl)phenoxy]-, (tetrahydro-2-furanyl)methyl ester |
| UNII:55408BLV3G |
| 55408BLV3G |
| Tetrahydro-2-furanylmethyl (2-(Aminocarbonyl)phenoxy)acetate |
| Tetrahydrofurfuryl (2-carbamoylphenoxy)acetate |
| 2075 |
| Tetrahydro-2-furanylmethyl (2-carbamoylphenoxy)acetate |
| Fenamifuril |