Introduction：Basic information about CAS 957014-38-9|Diphenylethyne-3,3',5,5'-tetracarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diphenylethyne-3,3',5,5'-tetracarboxylic acid |
|---|
| CAS Number | 957014-38-9 | Molecular Weight | 354.267 |
|---|
| Density | 1.7±0.1 g/cm3 | Boiling Point | 783.3±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H10O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 441.4±29.4 °C |
|---|
Names
| Name | 5,5′-(ethynylene)diisophthalic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.7±0.1 g/cm3 |
|---|
| Boiling Point | 783.3±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H10O8 |
|---|
| Molecular Weight | 354.267 |
|---|
| Flash Point | 441.4±29.4 °C |
|---|
| Exact Mass | 354.037567 |
|---|
| LogP | 3.66 |
|---|
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.742 |
|---|
| InChIKey | YFRIPYPPJIRELM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(C#Cc2cc(C(=O)O)cc(C(=O)O)c2)cc(C(=O)O)c1 |
|---|
Synonyms
| 5,5′-(ethynylene)diisophthalic acid |
| 1,3-Benzenedicarboxylic acid, 5,5'-(1,2-ethynediyl)bis- |
| 5,5'-(1,2-Ethynediyl)diisophthalic acid |
| Diphenylethyne-3,3',5,5'-tetracarboxylic acid |
