Introduction：Basic information about CAS 1440435-00-6|1,3-Bis[2,6-bis(1-ethylpropyl)phenyl]iMidazoliuM chloride, 98% IPentHCl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Bis[2,6-bis(1-ethylpropyl)phenyl]iMidazoliuM chloride, 98% IPentHCl |
|---|
| CAS Number | 1440435-00-6 | Molecular Weight | 537.26172 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C35H53ClN2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1,3-Bis[2,6-bis(1-ethylpropyl)phenyl]iMidazoliuM chloride, 98% IPentHCl |
|---|
Chemical & Physical Properties
| Molecular Formula | C35H53ClN2 |
|---|
| Molecular Weight | 537.26172 |
|---|
| Appearance of Characters | Powder |
|---|
| InChIKey | YMOZCDDUZSCLNF-UHFFFAOYSA-N |
|---|
| SMILES | CCC(CC)c1cccc(C(CC)CC)c1-n1[c-][n+](-c2c(C(CC)CC)cccc2C(CC)CC)cc1 |
|---|
