Introduction：Basic information about CAS 1440531-58-7|Lithium methyltriolborate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Lithium methyltriolborate |
|---|
| CAS Number | 1440531-58-7 | Molecular Weight | 135.72392 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | CH3BLi2O6 | Melting Point | >300℃ |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | LithiuM Methyltriolborate, 94% |
|---|
Chemical & Physical Properties
| Melting Point | >300℃ |
|---|
| Molecular Formula | CH3BLi2O6 |
|---|
| Molecular Weight | 135.72392 |
|---|
| Appearance of Characters | Solid |
|---|
| InChIKey | XBNPRRSOUJZBJY-UHFFFAOYSA-N |
|---|
| SMILES | C[B-]12COC(C)(OC1)OC2.[Li+] |
|---|
