Introduction：Basic information about CAS 1222629-57-3|4,7-seco-DoripeneM DisodiuM Salt (Mixture of double bond isoMers), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,7-seco-DoripeneM DisodiuM Salt (Mixture of double bond isoMers) |
|---|
| CAS Number | 1222629-57-3 | Molecular Weight | / |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | / | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4,7-seco-DoripeneM DisodiuM Salt (Mixture of double bond isoMers) |
|---|
Chemical & Physical Properties
| InChIKey | DGCDKVKIMXIBKA-VFZPANTDSA-N |
|---|
| SMILES | CC(O)C(C(=O)O)C1NC(C(=O)O)=C(SC2CNC(CNS(N)(=O)=O)C2)C1C |
|---|
