Introduction:Basic information about CAS 1454901-23-5|2-Fluoro-4-(4-methyl-1-piperazinylcarbonyl)benzeneboronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Fluoro-4-(4-methyl-1-piperazinylcarbonyl)benzeneboronic acid |
|---|
| CAS Number | 1454901-23-5 | Molecular Weight | 266.0764432 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H16BFN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-Fluoro-4-(4-methyl-1-piperazinylcarbonyl)benzeneboronic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H16BFN2O3 |
|---|
| Molecular Weight | 266.0764432 |
|---|
| Appearance of Characters | Crystals |
|---|
| InChIKey | RKKOTACNEFVADF-UHFFFAOYSA-N |
|---|
| SMILES | CN1CCN(C(=O)c2ccc(B(O)O)c(F)c2)CC1 |
|---|