Introduction:Basic information about CAS 68515-96-8|SULFUR AA STANDARD, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | SULFUR AA STANDARD |
|---|
| CAS Number | 68515-96-8 | Molecular Weight | 353.47628 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H27NO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
Chemical & Physical Properties
| Molecular Formula | C18H27NO4S |
|---|
| Molecular Weight | 353.47628 |
|---|
| Appearance of Characters | Liquid |
|---|
| InChIKey | DVOGPGMVVGVWRT-UHFFFAOYSA-N |
|---|
| SMILES | CCOCCOCCO.Oc1ccc(Nc2ccccc2)cc1.S |
|---|