Introduction：Basic information about CAS 752188-68-4|Olsalazine sodium EP Impurity B, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Olsalazine sodium EP Impurity B |
|---|
| CAS Number | 752188-68-4 | Molecular Weight | 302.239 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 625.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 332.4±31.5 °C |
|---|
Names
| Name | Olsalazine sodium EP Impurity B |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 625.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H10N2O6 |
|---|
| Molecular Weight | 302.239 |
|---|
| Flash Point | 332.4±31.5 °C |
|---|
| Exact Mass | 302.053894 |
|---|
| LogP | 3.70 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.678 |
|---|
| InChIKey | WWTUQHXVNBGBLR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(N=Nc2cccc(C(=O)O)c2O)ccc1O |
|---|
Synonyms
| 3-[(3-Carboxy-4-hydroxyphenyl)diazenyl]-2-hydroxybenzoic acid |
| Benzoic acid, 3-[2-(3-carboxy-4-hydroxyphenyl)diazenyl]-2-hydroxy- |
