Introduction:Basic information about CAS 213974-85-7|2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) |
|---|
| CAS Number | 213974-85-7 | Molecular Weight | 1100.1 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C24H12BF39O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-(Perfluorohexyl)-1-ethanol 1,1',1''-triester with boric acid (H3BO3) |
|---|
Chemical & Physical Properties
| Molecular Formula | C24H12BF39O3 |
|---|
| Molecular Weight | 1100.1 |
|---|
| InChIKey | OLNZYRAJMGESGX-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOB(OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|