Introduction：Basic information about CAS 70445-30-6|Benzene-1,2,4-tricarboxylic acid, diester with 1,1'-(isopropylidenebis(4,1-phenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzene-1,2,4-tricarboxylic acid, diester with 1,1'-(isopropylidenebis(4,1-phenyleneoxy))bis(3-phenoxypropan-2-ol) |
|---|
| CAS Number | 70445-30-6 | Molecular Weight | 912.9 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C51H44O16 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Benzene-1,2,4-tricarboxylic acid, diester with 1,1'-(isopropylidenebis(4,1-phenyleneoxy))bis(3-phenoxypropan-2-ol) |
|---|
Chemical & Physical Properties
| Molecular Formula | C51H44O16 |
|---|
| Molecular Weight | 912.9 |
|---|
| InChIKey | ZSKSIBAVTMSDSZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(c1ccc(OCC(COc2ccccc2)OC(=O)c2ccc(C(=O)O)cc2C(=O)O)cc1)c1ccc(OCC(COc2ccccc2)OC(=O)c2ccc(C(=O)O)cc2C(=O)O)cc1 |
|---|
