Introduction：Basic information about CAS 68315-84-4|Diazinon mixt. with Permethrin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diazinon mixt. with Permethrin |
|---|
| CAS Number | 68315-84-4 | Molecular Weight | 695.6 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C33H41Cl2N2O6PS | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Diazinon mixt. with Permethrin |
|---|
Chemical & Physical Properties
| Molecular Formula | C33H41Cl2N2O6PS |
|---|
| Molecular Weight | 695.6 |
|---|
| InChIKey | NJTZMSMRUQGGHZ-UHFFFAOYSA-N |
|---|
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OCc1cccc(Oc2ccccc2)c1.CCOP(=S)(OCC)Oc1cc(C)nc(C(C)C)n1 |
|---|
