Introduction:Basic information about CAS 68134-31-6|L-glycero-L-ido-Heptonic acid, cyclic 5,6-ester with boric acid (H3BO3), disodium sal, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | L-glycero-L-ido-Heptonic acid, cyclic 5,6-ester with boric acid (H3BO3), disodium salt |
|---|
| CAS Number | 68134-31-6 | Molecular Weight | 295.95 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C7H11BNa2O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | L-glycero-L-ido-Heptonic acid, cyclic 5,6-ester with boric acid (H3BO3), disodium salt |
|---|
Chemical & Physical Properties
| Molecular Formula | C7H11BNa2O9 |
|---|
| Molecular Weight | 295.95 |
|---|
| InChIKey | ISNQFWJNSHOAOY-UHFFFAOYSA-M |
|---|
| SMILES | O=C([O-])C(O)C(O)C(O)C1OB([O-])OC1CO.[Na+].[Na+] |
|---|