Introduction:Basic information about CAS 70191-39-8|Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester, mixt. with sulfur, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester, mixt. with sulfur |
|---|
| CAS Number | 70191-39-8 | Molecular Weight | 225.27 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H11N3O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Carbamic acid, N-1H-benzimidazol-2-yl-, methyl ester, mixt. with sulfur |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H11N3O2S |
|---|
| Molecular Weight | 225.27 |
|---|
| InChIKey | OFSDYOFNIDNMML-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)Nc1nc2ccccc2[nH]1.S |
|---|