Introduction:Basic information about CAS 42296-66-2|Bis(o-acetoxybenzoic) acid, diester with anthracene-1,8,9-triol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bis(o-acetoxybenzoic) acid, diester with anthracene-1,8,9-triol |
|---|
| CAS Number | 42296-66-2 | Molecular Weight | 550.5 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C32H22O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Bis(o-acetoxybenzoic) acid, diester with anthracene-1,8,9-triol |
|---|
Chemical & Physical Properties
| Molecular Formula | C32H22O9 |
|---|
| Molecular Weight | 550.5 |
|---|
| InChIKey | FOTCTYNWJWPSPI-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1ccccc1C(=O)Oc1cccc2cc3cccc(OC(=O)c4ccccc4OC(C)=O)c3c(O)c12 |
|---|