Introduction:Basic information about CAS 8012-23-5|Dextrose and sodium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dextrose and sodium chloride |
|---|
| CAS Number | 8012-23-5 | Molecular Weight | 238.60 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6H12ClNaO6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Dextrose and sodium chloride |
|---|
Chemical & Physical Properties
| Molecular Formula | C6H12ClNaO6 |
|---|
| Molecular Weight | 238.60 |
|---|
| InChIKey | PHPHRWZFQRLJIA-UZUGEDCSSA-M |
|---|
| SMILES | OCC1OC(O)C(O)C(O)C1O.[Cl-].[Na+] |
|---|