Introduction：Basic information about CAS 956970-00-6|Aspirin and oxycodone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Aspirin and oxycodone |
|---|
| CAS Number | 956970-00-6 | Molecular Weight | 495.5 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C27H29NO8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Aspirin and oxycodone |
|---|
Chemical & Physical Properties
| Molecular Formula | C27H29NO8 |
|---|
| Molecular Weight | 495.5 |
|---|
| InChIKey | SOVLIWPQFCJTTO-RKXJKUSZSA-N |
|---|
| SMILES | CC(=O)Oc1ccccc1C(=O)O.COc1ccc2c3c1OC1C(=O)CCC4(O)C(C2)N(C)CCC314 |
|---|
